About ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine
ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine (PubChem CID 143625580) has the molecular formula C17H25N3
and a molecular weight of 271.41 g/mol. Its IUPAC name is ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine.
Molecular Properties
| Compound Name | ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine |
| PubChem CID | 143625580 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine |
| SMILES | C=NC.CC.NNCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H14N2.C2H5N.C2H6/c14-15-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-3-2;1-2/h1-9,15H,10,14H2;1H2,2H3;1-2H3 |
| InChIKey | QHOKMMVPGBXBOY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine?
The IUPAC name of ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine (CID 143625580) is ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine.
What is the SMILES notation for ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine?
The canonical SMILES for ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine is C=NC.CC.NNCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine?
The InChIKey is QHOKMMVPGBXBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.C2H5N.C2H6/c14-15-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-3-2;1-2/h1-9,15H,10,14H2;1H2,2H3;1-2H3.
What are the key properties of ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine?
ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine has a molecular weight of 271.41 g/mol, XLogP of 3.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylmethanimine;(4-phenylphenyl)methylhydrazine is sourced from PubChem (CID 143625580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).