C8H10Cl2N4 — CID 143625634
N'-[amino(methyl)amino]-3,5-dichlorobenzenecarboximidamide (PubChem CID 143625634) has the molecular formula C8H10Cl2N4 and a molecular weight of 233.10 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-3,5-dichlorobenzenecarboximidamide.
| Compound Name | N'-[amino(methyl)amino]-3,5-dichlorobenzenecarboximidamide |
|---|---|
| PubChem CID | 143625634 |
| Molecular Formula | C8H10Cl2N4 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N'-[amino(methyl)amino]-3,5-dichlorobenzenecarboximidamide |
| SMILES | CN(N)/N=C(\N)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H10Cl2N4/c1-14(12)13-8(11)5-2-6(9)4-7(10)3-5/h2-4H,12H2,1H3,(H2,11,13) |
| InChIKey | VVRWNULQOSWISJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|