N-hydrazinylidenepentanimidamide;molecular hydrogen

C5H14N4 — CID 143625650

IUPACN-hydrazinylidenepentanimidamide;molecular hydrogen
SMILES[H]/N=C(CCCC)\N=N\N.[H][H]
InChIInChI=1S/C5H12N4.H2/c1-2-3-4-5(6)8-9-7;/h2-4H2,1H3,(H3,6,7,8);1H
InChIKeyKUCNWBPPFBSJLQ-UHFFFAOYSA-N
MW130.20 g/mol
LogP1.73
Rot. Bonds3

About N-hydrazinylidenepentanimidamide;molecular hydrogen

N-hydrazinylidenepentanimidamide;molecular hydrogen (PubChem CID 143625650) has the molecular formula C5H14N4 and a molecular weight of 130.20 g/mol. Its IUPAC name is N-hydrazinylidenepentanimidamide;molecular hydrogen.

Molecular Properties

Compound NameN-hydrazinylidenepentanimidamide;molecular hydrogen
PubChem CID143625650
Molecular FormulaC5H14N4
Molecular Weight130.20 g/mol
Exact Mass130.12
IUPAC NameN-hydrazinylidenepentanimidamide;molecular hydrogen
SMILES[H]/N=C(CCCC)\N=N\N.[H][H]
InChIInChI=1S/C5H12N4.H2/c1-2-3-4-5(6)8-9-7;/h2-4H2,1H3,(H3,6,7,8);1H
InChIKeyKUCNWBPPFBSJLQ-UHFFFAOYSA-N
XLogP1.73
TPSA74.59 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.20
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze N-hydrazinylidenepentanimidamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-hydrazinylidenepentanimidamide;molecular hydrogen?
The IUPAC name of N-hydrazinylidenepentanimidamide;molecular hydrogen (CID 143625650) is N-hydrazinylidenepentanimidamide;molecular hydrogen.
What is the SMILES notation for N-hydrazinylidenepentanimidamide;molecular hydrogen?
The canonical SMILES for N-hydrazinylidenepentanimidamide;molecular hydrogen is [H]/N=C(CCCC)\N=N\N.[H][H].
What is the InChIKey of N-hydrazinylidenepentanimidamide;molecular hydrogen?
The InChIKey is KUCNWBPPFBSJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4.H2/c1-2-3-4-5(6)8-9-7;/h2-4H2,1H3,(H3,6,7,8);1H.
What are the key properties of N-hydrazinylidenepentanimidamide;molecular hydrogen?
N-hydrazinylidenepentanimidamide;molecular hydrogen has a molecular weight of 130.20 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydrazinylidenepentanimidamide;molecular hydrogen is sourced from PubChem (CID 143625650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).