About (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane
(Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane (PubChem CID 143625747) has the molecular formula C18H18F2N2O
and a molecular weight of 316.35 g/mol. Its IUPAC name is (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane.
Molecular Properties
| Compound Name | (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane |
| PubChem CID | 143625747 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane |
| SMILES | CC.[H]/N=C/C(=C(\C(N)=O)c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H12F2N2O.C2H6/c17-12-5-1-3-10(7-12)14(9-19)15(16(20)21)11-4-2-6-13(18)8-11;1-2/h1-9,19H,(H2,20,21);1-2H3/b15-14+,19-9+; |
| InChIKey | SIDHOQNZIMBIJW-NVHZTXMFSA-N |
| XLogP | 4.04 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane?
The IUPAC name of (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane (CID 143625747) is (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane.
What is the SMILES notation for (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane?
The canonical SMILES for (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane is CC.[H]/N=C/C(=C(\C(N)=O)c1cccc(F)c1)c1cccc(F)c1.
What is the InChIKey of (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane?
The InChIKey is SIDHOQNZIMBIJW-NVHZTXMFSA-N. The full InChI is InChI=1S/C16H12F2N2O.C2H6/c17-12-5-1-3-10(7-12)14(9-19)15(16(20)21)11-4-2-6-13(18)8-11;1-2/h1-9,19H,(H2,20,21);1-2H3/b15-14+,19-9+;.
What are the key properties of (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane?
(Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane has a molecular weight of 316.35 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-bis(3-fluorophenyl)-4-iminobut-2-enamide;ethane is sourced from PubChem (CID 143625747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).