About 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane
1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane (PubChem CID 143625965) has the molecular formula C18H32F4N2O2
and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane.
Molecular Properties
| Compound Name | 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane |
| PubChem CID | 143625965 |
| Molecular Formula | C18H32F4N2O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane |
| SMILES | CC.CCC(=O)N1CCC(F)(F)CC1.CCC(=O)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/2C8H13F2NO.C2H6/c1-2-7(12)11-5-3-8(9,10)4-6-11;1-2-7(12)11-5-3-4-8(9,10)6-11;1-2/h2*2-6H2,1H3;1-2H3 |
| InChIKey | CYDSSNFYGRQSIH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane?
The IUPAC name of 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane (CID 143625965) is 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane.
What is the SMILES notation for 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane?
The canonical SMILES for 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane is CC.CCC(=O)N1CCC(F)(F)CC1.CCC(=O)N1CCCC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane?
The InChIKey is CYDSSNFYGRQSIH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H13F2NO.C2H6/c1-2-7(12)11-5-3-8(9,10)4-6-11;1-2-7(12)11-5-3-4-8(9,10)6-11;1-2/h2*2-6H2,1H3;1-2H3.
What are the key properties of 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane?
1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane has a molecular weight of 384.46 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoropiperidin-1-yl)propan-1-one;1-(4,4-difluoropiperidin-1-yl)propan-1-one;ethane is sourced from PubChem (CID 143625965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).