C24H26N6O3S — CID 143626229
[3-cyano-2-[[(2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate (PubChem CID 143626229) has the molecular formula C24H26N6O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is [3-cyano-2-[[(2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate.
| Compound Name | [3-cyano-2-[[(2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 143626229 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [3-cyano-2-[[(2E,4E)-4-[(methylideneamino)methylidene]hexa-2,5-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-[(2,5-dimethylpyrazol-3-yl)methyl]carbamate |
| SMILES | C=CC(/C=C/C(=O)Nc1sc2c(c1C#N)CCC(OC(=O)NCc1cc(C)nn1C)C2)=C\N=C |
| InChI | InChI=1S/C24H26N6O3S/c1-5-16(13-26-3)6-9-22(31)28-23-20(12-25)19-8-7-18(11-21(19)34-23)33-24(32)27-14-17-10-15(2)29-30(17)4/h5-6,9-10,13,18H,1,3,7-8,11,14H2,2,4H3,(H,27,32)(H,28,31)/b9-6+,16-13+ |
| InChIKey | HUUTWLVXQQRUAT-WFCWMHMYSA-N |
| XLogP | 3.71 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|