About cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine
cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine (PubChem CID 143626574) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine.
Molecular Properties
| Compound Name | cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine |
| PubChem CID | 143626574 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine |
| SMILES | C1CCCC1.CN.O=c1[nH]ccc2cc(O)ccc12 |
| InChI | InChI=1S/C9H7NO2.C5H10.CH5N/c11-7-1-2-8-6(5-7)3-4-10-9(8)12;1-2-4-5-3-1;1-2/h1-5,11H,(H,10,12);1-5H2;2H2,1H3 |
| InChIKey | FDXTXDWEIYAPAP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine?
The IUPAC name of cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine (CID 143626574) is cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine.
What is the SMILES notation for cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine?
The canonical SMILES for cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine is C1CCCC1.CN.O=c1[nH]ccc2cc(O)ccc12.
What is the InChIKey of cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine?
The InChIKey is FDXTXDWEIYAPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C5H10.CH5N/c11-7-1-2-8-6(5-7)3-4-10-9(8)12;1-2-4-5-3-1;1-2/h1-5,11H,(H,10,12);1-5H2;2H2,1H3.
What are the key properties of cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine?
cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine has a molecular weight of 262.35 g/mol, XLogP of 2.76, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;6-hydroxy-2H-isoquinolin-1-one;methanamine is sourced from PubChem (CID 143626574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).