About cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one
cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one (PubChem CID 143626578) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one |
| PubChem CID | 143626578 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one |
| SMILES | NC1CCCC1.O=c1[nH]ccc2cc(O)ccc12 |
| InChI | InChI=1S/C9H7NO2.C5H11N/c11-7-1-2-8-6(5-7)3-4-10-9(8)12;6-5-3-1-2-4-5/h1-5,11H,(H,10,12);5H,1-4,6H2 |
| InChIKey | FTPSPZBFYKCEPN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one?
The IUPAC name of cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one (CID 143626578) is cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one.
What is the SMILES notation for cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one?
The canonical SMILES for cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one is NC1CCCC1.O=c1[nH]ccc2cc(O)ccc12.
What is the InChIKey of cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one?
The InChIKey is FTPSPZBFYKCEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C5H11N/c11-7-1-2-8-6(5-7)3-4-10-9(8)12;6-5-3-1-2-4-5/h1-5,11H,(H,10,12);5H,1-4,6H2.
What are the key properties of cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one?
cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one has a molecular weight of 246.31 g/mol, XLogP of 2.12, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanamine;6-hydroxy-2H-isoquinolin-1-one is sourced from PubChem (CID 143626578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).