About (1,4-diethylpiperidin-4-yl) acetate
(1,4-diethylpiperidin-4-yl) acetate (PubChem CID 143626837) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (1,4-diethylpiperidin-4-yl) acetate.
Molecular Properties
| Compound Name | (1,4-diethylpiperidin-4-yl) acetate |
| PubChem CID | 143626837 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (1,4-diethylpiperidin-4-yl) acetate |
| SMILES | CCN1CCC(CC)(OC(C)=O)CC1 |
| InChI | InChI=1S/C11H21NO2/c1-4-11(14-10(3)13)6-8-12(5-2)9-7-11/h4-9H2,1-3H3 |
| InChIKey | SEQYVRNSIOBZST-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1,4-diethylpiperidin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-diethylpiperidin-4-yl) acetate?
The IUPAC name of (1,4-diethylpiperidin-4-yl) acetate (CID 143626837) is (1,4-diethylpiperidin-4-yl) acetate.
What is the SMILES notation for (1,4-diethylpiperidin-4-yl) acetate?
The canonical SMILES for (1,4-diethylpiperidin-4-yl) acetate is CCN1CCC(CC)(OC(C)=O)CC1.
What is the InChIKey of (1,4-diethylpiperidin-4-yl) acetate?
The InChIKey is SEQYVRNSIOBZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-4-11(14-10(3)13)6-8-12(5-2)9-7-11/h4-9H2,1-3H3.
What are the key properties of (1,4-diethylpiperidin-4-yl) acetate?
(1,4-diethylpiperidin-4-yl) acetate has a molecular weight of 199.29 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-diethylpiperidin-4-yl) acetate is sourced from PubChem (CID 143626837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).