C21H22N4S — CID 143627755
3-[(3E,5Z)-7-amino-5-methylocta-3,5,7-trien-4-yl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione (PubChem CID 143627755) has the molecular formula C21H22N4S and a molecular weight of 362.50 g/mol. Its IUPAC name is 3-[(3E,5Z)-7-amino-5-methylocta-3,5,7-trien-4-yl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(3E,5Z)-7-amino-5-methylocta-3,5,7-trien-4-yl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143627755 |
| Molecular Formula | C21H22N4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[(3E,5Z)-7-amino-5-methylocta-3,5,7-trien-4-yl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
| SMILES | C=C(N)/C=C(C)\C(=C/CC)c1n[nH]c(=S)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N4S/c1-4-8-17(14(2)13-15(3)22)20-23-24-21(26)25(20)19-12-7-10-16-9-5-6-11-18(16)19/h5-13H,3-4,22H2,1-2H3,(H,24,26)/b14-13-,17-8+ |
| InChIKey | LRNJGALPIMTJBL-WNWIYMBOSA-N |
| XLogP | 5.30 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|