C23H23N5S — CID 143627758
2-ethyl-5-methyl-4-[4-(1-propan-2-ylindol-4-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]benzonitrile (PubChem CID 143627758) has the molecular formula C23H23N5S and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-ethyl-5-methyl-4-[4-(1-propan-2-ylindol-4-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]benzonitrile.
| Compound Name | 2-ethyl-5-methyl-4-[4-(1-propan-2-ylindol-4-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 143627758 |
| Molecular Formula | C23H23N5S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-ethyl-5-methyl-4-[4-(1-propan-2-ylindol-4-yl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]benzonitrile |
| SMILES | CCc1cc(-c2n[nH]c(=S)n2-c2cccc3c2ccn3C(C)C)c(C)cc1C#N |
| InChI | InChI=1S/C23H23N5S/c1-5-16-12-19(15(4)11-17(16)13-24)22-25-26-23(29)28(22)21-8-6-7-20-18(21)9-10-27(20)14(2)3/h6-12,14H,5H2,1-4H3,(H,26,29) |
| InChIKey | KJNCPUYIYMOGAG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 62.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|