C27H27F3N2O2 — CID 143629520
3,3-difluorobut-1-en-2-ol;3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-5-fluorobenzamide (PubChem CID 143629520) has the molecular formula C27H27F3N2O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 3,3-difluorobut-1-en-2-ol;3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-5-fluorobenzamide.
| Compound Name | 3,3-difluorobut-1-en-2-ol;3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 143629520 |
| Molecular Formula | C27H27F3N2O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3,3-difluorobut-1-en-2-ol;3-[4-[(2,3-dihydro-1H-inden-2-ylamino)methyl]phenyl]-5-fluorobenzamide |
| SMILES | C=C(O)C(C)(F)F.NC(=O)c1cc(F)cc(-c2ccc(CNC3Cc4ccccc4C3)cc2)c1 |
| InChI | InChI=1S/C23H21FN2O.C4H6F2O/c24-21-10-19(9-20(11-21)23(25)27)16-7-5-15(6-8-16)14-26-22-12-17-3-1-2-4-18(17)13-22;1-3(7)4(2,5)6/h1-11,22,26H,12-14H2,(H2,25,27);7H,1H2,2H3 |
| InChIKey | WGOXWLYDOPTATK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|