About ethane;2-methyl-1,3-thiazol-4-one
ethane;2-methyl-1,3-thiazol-4-one (PubChem CID 143629922) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is ethane;2-methyl-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | ethane;2-methyl-1,3-thiazol-4-one |
| PubChem CID | 143629922 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | ethane;2-methyl-1,3-thiazol-4-one |
| SMILES | CC.CC1=NC(=O)CS1 |
| InChI | InChI=1S/C4H5NOS.C2H6/c1-3-5-4(6)2-7-3;1-2/h2H2,1H3;1-2H3 |
| InChIKey | FOQMUTWFSRTERQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methyl-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-1,3-thiazol-4-one?
The IUPAC name of ethane;2-methyl-1,3-thiazol-4-one (CID 143629922) is ethane;2-methyl-1,3-thiazol-4-one.
What is the SMILES notation for ethane;2-methyl-1,3-thiazol-4-one?
The canonical SMILES for ethane;2-methyl-1,3-thiazol-4-one is CC.CC1=NC(=O)CS1.
What is the InChIKey of ethane;2-methyl-1,3-thiazol-4-one?
The InChIKey is FOQMUTWFSRTERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NOS.C2H6/c1-3-5-4(6)2-7-3;1-2/h2H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-1,3-thiazol-4-one?
ethane;2-methyl-1,3-thiazol-4-one has a molecular weight of 145.23 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1,3-thiazol-4-one is sourced from PubChem (CID 143629922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).