About 4-methyl-5-sulfanyl-1,3-dioxol-2-one
4-methyl-5-sulfanyl-1,3-dioxol-2-one (PubChem CID 143629978) has the molecular formula C4H4O3S
and a molecular weight of 132.14 g/mol. Its IUPAC name is 4-methyl-5-sulfanyl-1,3-dioxol-2-one.
Molecular Properties
| Compound Name | 4-methyl-5-sulfanyl-1,3-dioxol-2-one |
| PubChem CID | 143629978 |
| Molecular Formula | C4H4O3S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 131.99 |
| IUPAC Name | 4-methyl-5-sulfanyl-1,3-dioxol-2-one |
| SMILES | Cc1oc(=O)oc1S |
| InChI | InChI=1S/C4H4O3S/c1-2-3(8)7-4(5)6-2/h8H,1H3 |
| InChIKey | WMQUPFMODMROMK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 43.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-sulfanyl-1,3-dioxol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-sulfanyl-1,3-dioxol-2-one?
The IUPAC name of 4-methyl-5-sulfanyl-1,3-dioxol-2-one (CID 143629978) is 4-methyl-5-sulfanyl-1,3-dioxol-2-one.
What is the SMILES notation for 4-methyl-5-sulfanyl-1,3-dioxol-2-one?
The canonical SMILES for 4-methyl-5-sulfanyl-1,3-dioxol-2-one is Cc1oc(=O)oc1S.
What is the InChIKey of 4-methyl-5-sulfanyl-1,3-dioxol-2-one?
The InChIKey is WMQUPFMODMROMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O3S/c1-2-3(8)7-4(5)6-2/h8H,1H3.
What are the key properties of 4-methyl-5-sulfanyl-1,3-dioxol-2-one?
4-methyl-5-sulfanyl-1,3-dioxol-2-one has a molecular weight of 132.14 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-sulfanyl-1,3-dioxol-2-one is sourced from PubChem (CID 143629978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).