C11H20N2O4 — CID 14363
(3-carbamoyloxy-2-cyclopentyl-2-methylpropyl) carbamate (PubChem CID 14363) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3-carbamoyloxy-2-cyclopentyl-2-methylpropyl) carbamate.
| Compound Name | (3-carbamoyloxy-2-cyclopentyl-2-methylpropyl) carbamate |
|---|---|
| PubChem CID | 14363 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (3-carbamoyloxy-2-cyclopentyl-2-methylpropyl) carbamate |
| SMILES | CC(COC(N)=O)(COC(N)=O)C1CCCC1 |
| InChI | InChI=1S/C11H20N2O4/c1-11(6-16-9(12)14,7-17-10(13)15)8-4-2-3-5-8/h8H,2-7H2,1H3,(H2,12,14)(H2,13,15) |
| InChIKey | MYCUGBCULANECB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |