C16H25NO2 — CID 143630259
ethane;1-(4-hydroxypiperidin-1-yl)-1-phenylpropan-2-one (PubChem CID 143630259) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is ethane;1-(4-hydroxypiperidin-1-yl)-1-phenylpropan-2-one.
| Compound Name | ethane;1-(4-hydroxypiperidin-1-yl)-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 143630259 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | ethane;1-(4-hydroxypiperidin-1-yl)-1-phenylpropan-2-one |
| SMILES | CC.CC(=O)C(c1ccccc1)N1CCC(O)CC1 |
| InChI | InChI=1S/C14H19NO2.C2H6/c1-11(16)14(12-5-3-2-4-6-12)15-9-7-13(17)8-10-15;1-2/h2-6,13-14,17H,7-10H2,1H3;1-2H3 |
| InChIKey | XTSLCLQLRPZRMR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |