molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one

C4H8N4O — CID 143630465

IUPACmolecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one
SMILESCC(=O)Cc1nn[nH]n1.[H][H]
InChIInChI=1S/C4H6N4O.H2/c1-3(9)2-4-5-7-8-6-4;/h2H2,1H3,(H,5,6,7,8);1H
InChIKeyUITVFJAXJXPNBP-UHFFFAOYSA-N
MW128.13 g/mol
LogP-0.42
Rot. Bonds2

About molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one

molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one (PubChem CID 143630465) has the molecular formula C4H8N4O and a molecular weight of 128.13 g/mol. Its IUPAC name is molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one.

Molecular Properties

Compound Namemolecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one
PubChem CID143630465
Molecular FormulaC4H8N4O
Molecular Weight128.13 g/mol
Exact Mass128.07
IUPAC Namemolecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one
SMILESCC(=O)Cc1nn[nH]n1.[H][H]
InChIInChI=1S/C4H6N4O.H2/c1-3(9)2-4-5-7-8-6-4;/h2H2,1H3,(H,5,6,7,8);1H
InChIKeyUITVFJAXJXPNBP-UHFFFAOYSA-N
XLogP-0.42
TPSA71.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.13
LogP ≤ 5-0.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one?
The IUPAC name of molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one (CID 143630465) is molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one.
What is the SMILES notation for molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one?
The canonical SMILES for molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one is CC(=O)Cc1nn[nH]n1.[H][H].
What is the InChIKey of molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one?
The InChIKey is UITVFJAXJXPNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O.H2/c1-3(9)2-4-5-7-8-6-4;/h2H2,1H3,(H,5,6,7,8);1H.
What are the key properties of molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one?
molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one has a molecular weight of 128.13 g/mol, XLogP of -0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1-(2H-tetrazol-5-yl)propan-2-one is sourced from PubChem (CID 143630465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).