C20H50Cl2O6Si6 — CID 14363073
2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decaethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 14363073) has the molecular formula C20H50Cl2O6Si6 and a molecular weight of 626.04 g/mol. Its IUPAC name is 2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decaethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decaethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 14363073 |
| Molecular Formula | C20H50Cl2O6Si6 |
| Molecular Weight | 626.04 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 2,8-dichloro-2,4,4,6,6,8,10,10,12,12-decaethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | CC[Si]1(Cl)O[Si](CC)(CC)O[Si](CC)(CC)O[Si](Cl)(CC)O[Si](CC)(CC)O[Si](CC)(CC)O1 |
| InChI | InChI=1S/C20H50Cl2O6Si6/c1-11-29(12-2)23-30(13-3,14-4)26-34(22,20-10)28-32(17-7,18-8)24-31(15-5,16-6)27-33(21,19-9)25-29/h11-20H2,1-10H3 |
| InChIKey | IXVDTSVSBDPYPO-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.04 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|