C16H42O7Si5 — CID 14363076
2,2,4,4,6,8,8,10-octaethyl-6,10-dihydroxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 14363076) has the molecular formula C16H42O7Si5 and a molecular weight of 486.94 g/mol. Its IUPAC name is 2,2,4,4,6,8,8,10-octaethyl-6,10-dihydroxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,2,4,4,6,8,8,10-octaethyl-6,10-dihydroxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 14363076 |
| Molecular Formula | C16H42O7Si5 |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2,2,4,4,6,8,8,10-octaethyl-6,10-dihydroxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC[Si]1(O)O[Si](CC)(CC)O[Si](O)(CC)O[Si](CC)(CC)O[Si](CC)(CC)O1 |
| InChI | InChI=1S/C16H42O7Si5/c1-9-24(10-2)19-25(11-3,12-4)21-28(18,16-8)23-26(13-5,14-6)22-27(17,15-7)20-24/h17-18H,9-16H2,1-8H3 |
| InChIKey | IIBYCCRKRPQNJB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|