About ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine
ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 143630973) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 143630973 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | CC.CC1=C/C(=N/N)C(N)C=C1C |
| InChI | InChI=1S/C8H13N3.C2H6/c1-5-3-7(9)8(11-10)4-6(5)2;1-2/h3-4,7H,9-10H2,1-2H3;1-2H3/b11-8-; |
| InChIKey | UFJOYSZBLZPTRH-MKFZHGHUSA-N |
| XLogP | 1.56 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine (CID 143630973) is ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine is CC.CC1=C/C(=N/N)C(N)C=C1C.
What is the InChIKey of ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is UFJOYSZBLZPTRH-MKFZHGHUSA-N. The full InChI is InChI=1S/C8H13N3.C2H6/c1-5-3-7(9)8(11-10)4-6(5)2;1-2/h3-4,7H,9-10H2,1-2H3;1-2H3/b11-8-;.
What are the key properties of ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine?
ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 181.28 g/mol, XLogP of 1.56, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(6Z)-6-hydrazinylidene-3,4-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 143630973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).