C20H23N3O2 — CID 143631199
(E)-3-[3-[6-[(4-aminocyclohexyl)methyl]pyrazin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 143631199) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (E)-3-[3-[6-[(4-aminocyclohexyl)methyl]pyrazin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[6-[(4-aminocyclohexyl)methyl]pyrazin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 143631199 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (E)-3-[3-[6-[(4-aminocyclohexyl)methyl]pyrazin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | NC1CCC(Cc2cncc(-c3cccc(/C=C/C(=O)O)c3)n2)CC1 |
| InChI | InChI=1S/C20H23N3O2/c21-17-7-4-15(5-8-17)11-18-12-22-13-19(23-18)16-3-1-2-14(10-16)6-9-20(24)25/h1-3,6,9-10,12-13,15,17H,4-5,7-8,11,21H2,(H,24,25)/b9-6+ |
| InChIKey | ATIFSQFISAIICZ-RMKNXTFCSA-N |
| XLogP | 3.30 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|