About ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide
ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide (PubChem CID 143631455) has the molecular formula C14H24N2O3S
and a molecular weight of 300.42 g/mol. Its IUPAC name is ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide |
| PubChem CID | 143631455 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide |
| SMILES | CC.CC.CN(Cc1nccc2occc12)S(C)(=O)=O |
| InChI | InChI=1S/C10H12N2O3S.2C2H6/c1-12(16(2,13)14)7-9-8-4-6-15-10(8)3-5-11-9;2*1-2/h3-6H,7H2,1-2H3;2*1-2H3 |
| InChIKey | SZXIFLWKKNHKNP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide?
The IUPAC name of ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide (CID 143631455) is ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide.
What is the SMILES notation for ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide?
The canonical SMILES for ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide is CC.CC.CN(Cc1nccc2occc12)S(C)(=O)=O.
What is the InChIKey of ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide?
The InChIKey is SZXIFLWKKNHKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3S.2C2H6/c1-12(16(2,13)14)7-9-8-4-6-15-10(8)3-5-11-9;2*1-2/h3-6H,7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide?
ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide has a molecular weight of 300.42 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(furo[3,2-c]pyridin-4-ylmethyl)-N-methylmethanesulfonamide is sourced from PubChem (CID 143631455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).