C13H19N3O5 — CID 143631497
N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]pyridine-4-carboxamide;methanol (PubChem CID 143631497) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]pyridine-4-carboxamide;methanol.
| Compound Name | N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]pyridine-4-carboxamide;methanol |
|---|---|
| PubChem CID | 143631497 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]pyridine-4-carboxamide;methanol |
| SMILES | CC(=O)CNC(=O)C(CO)NC(=O)c1ccncc1.CO |
| InChI | InChI=1S/C12H15N3O4.CH4O/c1-8(17)6-14-12(19)10(7-16)15-11(18)9-2-4-13-5-3-9;1-2/h2-5,10,16H,6-7H2,1H3,(H,14,19)(H,15,18);2H,1H3 |
| InChIKey | AVCDIXGWMKHXIT-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |