About N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine
N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine (PubChem CID 143632415) has the molecular formula C19H28N4
and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine |
| PubChem CID | 143632415 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine |
| SMILES | CN(CCN1CCN(c2ccncc2)CC1)CC1=CCCC=C1 |
| InChI | InChI=1S/C19H28N4/c1-21(17-18-5-3-2-4-6-18)11-12-22-13-15-23(16-14-22)19-7-9-20-10-8-19/h3,5-10H,2,4,11-17H2,1H3 |
| InChIKey | QTURJIHKLKRSDO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine (CID 143632415) is N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine is CN(CCN1CCN(c2ccncc2)CC1)CC1=CCCC=C1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine?
The InChIKey is QTURJIHKLKRSDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4/c1-21(17-18-5-3-2-4-6-18)11-12-22-13-15-23(16-14-22)19-7-9-20-10-8-19/h3,5-10H,2,4,11-17H2,1H3.
What are the key properties of N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine?
N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine has a molecular weight of 312.46 g/mol, XLogP of 2.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylmethyl)-N-methyl-2-(4-pyridin-4-ylpiperazin-1-yl)ethanamine is sourced from PubChem (CID 143632415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).