C26H23NO3 — CID 143632818
1-[2-(7,8-didehydro-5,6,9,10-tetrahydrobenzo[8]annulen-3-yl)-2-oxoethyl]-4-phenylmethoxypyridin-2-one (PubChem CID 143632818) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 1-[2-(7,8-didehydro-5,6,9,10-tetrahydrobenzo[8]annulen-3-yl)-2-oxoethyl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-[2-(7,8-didehydro-5,6,9,10-tetrahydrobenzo[8]annulen-3-yl)-2-oxoethyl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 143632818 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-[2-(7,8-didehydro-5,6,9,10-tetrahydrobenzo[8]annulen-3-yl)-2-oxoethyl]-4-phenylmethoxypyridin-2-one |
| SMILES | O=C(Cn1ccc(OCc2ccccc2)cc1=O)c1ccc2c(c1)CCC#CCC2 |
| InChI | InChI=1S/C26H23NO3/c28-25(23-13-12-21-10-6-1-2-7-11-22(21)16-23)18-27-15-14-24(17-26(27)29)30-19-20-8-4-3-5-9-20/h3-5,8-9,12-17H,6-7,10-11,18-19H2 |
| InChIKey | VELRHNGAWOXOIF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|