C24H36N5O3S+ — CID 143632983
[2-[[2-[4-(ethylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methoxy]-2-methylpropyl]-methylsulfanium (PubChem CID 143632983) has the molecular formula C24H36N5O3S+ and a molecular weight of 474.65 g/mol. Its IUPAC name is [2-[[2-[4-(ethylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methoxy]-2-methylpropyl]-methylsulfanium.
| Compound Name | [2-[[2-[4-(ethylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methoxy]-2-methylpropyl]-methylsulfanium |
|---|---|
| PubChem CID | 143632983 |
| Molecular Formula | C24H36N5O3S+ |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | [2-[[2-[4-(ethylcarbamoylamino)phenyl]-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methoxy]-2-methylpropyl]-methylsulfanium |
| SMILES | CCNC(=O)Nc1ccc(-c2nc(COC(C)(C)C[SH+]C)cc(N3CCOC[C@@H]3C)n2)cc1 |
| InChI | InChI=1S/C24H35N5O3S/c1-6-25-23(30)27-19-9-7-18(8-10-19)22-26-20(15-32-24(3,4)16-33-5)13-21(28-22)29-11-12-31-14-17(29)2/h7-10,13,17H,6,11-12,14-16H2,1-5H3,(H2,25,27,30)/p+1/t17-/m0/s1 |
| InChIKey | HNVQNACRKHFMOF-KRWDZBQOSA-O |
| XLogP | 3.25 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|