C32H33NO — CID 143633402
[2-methyl-5-[(2E,4E)-6-methyl-5-[C-methyl-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]hepta-2,4,6-trien-2-yl]phenyl]methanol (PubChem CID 143633402) has the molecular formula C32H33NO and a molecular weight of 447.62 g/mol. Its IUPAC name is [2-methyl-5-[(2E,4E)-6-methyl-5-[C-methyl-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]hepta-2,4,6-trien-2-yl]phenyl]methanol.
| Compound Name | [2-methyl-5-[(2E,4E)-6-methyl-5-[C-methyl-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]hepta-2,4,6-trien-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 143633402 |
| Molecular Formula | C32H33NO |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | [2-methyl-5-[(2E,4E)-6-methyl-5-[C-methyl-N-[1-(3-phenylphenyl)ethenyl]carbonimidoyl]hepta-2,4,6-trien-2-yl]phenyl]methanol |
| SMILES | C=C(C)C(=C\C=C(/C)c1ccc(C)c(CO)c1)/C(C)=N\C(=C)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C32H33NO/c1-22(2)32(18-16-23(3)28-17-15-24(4)31(19-28)21-34)26(6)33-25(5)29-13-10-14-30(20-29)27-11-8-7-9-12-27/h7-20,34H,1,5,21H2,2-4,6H3/b23-16+,32-18+,33-26+ |
| InChIKey | DZBHXGJATBZWJG-UXGRROMNSA-N |
| XLogP | 8.19 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|