C25H26F3N3O — CID 143634126
4-(propylaminomethyl)-N'-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]benzenecarboximidamide (PubChem CID 143634126) has the molecular formula C25H26F3N3O and a molecular weight of 441.50 g/mol. Its IUPAC name is 4-(propylaminomethyl)-N'-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]benzenecarboximidamide.
| Compound Name | 4-(propylaminomethyl)-N'-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 143634126 |
| Molecular Formula | C25H26F3N3O |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-(propylaminomethyl)-N'-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]benzenecarboximidamide |
| SMILES | CCCNCc1ccc(/C(N)=N/OCc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H26F3N3O/c1-2-15-30-16-18-3-9-22(10-4-18)24(29)31-32-17-19-5-7-20(8-6-19)21-11-13-23(14-12-21)25(26,27)28/h3-14,30H,2,15-17H2,1H3,(H2,29,31) |
| InChIKey | SNBYYGQWTIODKU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|