C25H36N2O3 — CID 143634141
11-[3-(dimethylamino)propyl]-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-4,4a,6,11a-tetrahydro-3H-benzo[c][1]benzoxepin-11-ol (PubChem CID 143634141) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 11-[3-(dimethylamino)propyl]-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-4,4a,6,11a-tetrahydro-3H-benzo[c][1]benzoxepin-11-ol.
| Compound Name | 11-[3-(dimethylamino)propyl]-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-4,4a,6,11a-tetrahydro-3H-benzo[c][1]benzoxepin-11-ol |
|---|---|
| PubChem CID | 143634141 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 11-[3-(dimethylamino)propyl]-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-4,4a,6,11a-tetrahydro-3H-benzo[c][1]benzoxepin-11-ol |
| SMILES | CN(C)CCCC1(O)c2ccccc2COC2CCC(CC3=NC(C)(C)CO3)=CC21 |
| InChI | InChI=1S/C25H36N2O3/c1-24(2)17-30-23(26-24)15-18-10-11-22-21(14-18)25(28,12-7-13-27(3)4)20-9-6-5-8-19(20)16-29-22/h5-6,8-9,14,21-22,28H,7,10-13,15-17H2,1-4H3 |
| InChIKey | LUJLFHVFGJBWKV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|