About 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one
4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one (PubChem CID 143634310) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one |
| PubChem CID | 143634310 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one |
| SMILES | CCCN1C(N)=CC(=O)NC1O |
| InChI | InChI=1S/C7H13N3O2/c1-2-3-10-5(8)4-6(11)9-7(10)12/h4,7,12H,2-3,8H2,1H3,(H,9,11) |
| InChIKey | XHILJQGWDPDKOL-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one?
The IUPAC name of 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one (CID 143634310) is 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one.
What is the SMILES notation for 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one?
The canonical SMILES for 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one is CCCN1C(N)=CC(=O)NC1O.
What is the InChIKey of 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one?
The InChIKey is XHILJQGWDPDKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-2-3-10-5(8)4-6(11)9-7(10)12/h4,7,12H,2-3,8H2,1H3,(H,9,11).
What are the key properties of 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one?
4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one has a molecular weight of 171.20 g/mol, XLogP of -1.10, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-hydroxy-3-propyl-1,2-dihydropyrimidin-6-one is sourced from PubChem (CID 143634310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).