C22H31FO6 — CID 143634410
[(1R,8S,9R,10S,12R)-8-fluoro-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate (PubChem CID 143634410) has the molecular formula C22H31FO6 and a molecular weight of 410.48 g/mol. Its IUPAC name is [(1R,8S,9R,10S,12R)-8-fluoro-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate.
| Compound Name | [(1R,8S,9R,10S,12R)-8-fluoro-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate |
|---|---|
| PubChem CID | 143634410 |
| Molecular Formula | C22H31FO6 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [(1R,8S,9R,10S,12R)-8-fluoro-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)[C@@]2(C)C(C[C@]3(O)CCC(C)=C1C3(C)C)C1COC1[C@@H](F)[C@@H]2O |
| InChI | InChI=1S/C22H31FO6/c1-10-6-7-22(27)8-13-12-9-28-16(12)15(23)18(25)21(13,5)19(26)17(29-11(2)24)14(10)20(22,3)4/h12-13,15-18,25,27H,6-9H2,1-5H3/t12?,13?,15-,16?,17-,18+,21+,22-/m1/s1 |
| InChIKey | HVACHDKWTOJRMC-MDVFFXJDSA-N |
| XLogP | 2.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|