C22H34FNO5Si — CID 143634869
(3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(6-fluoro-2-methoxy-3-methylphenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 143634869) has the molecular formula C22H34FNO5Si and a molecular weight of 439.60 g/mol. Its IUPAC name is (3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(6-fluoro-2-methoxy-3-methylphenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(6-fluoro-2-methoxy-3-methylphenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 143634869 |
| Molecular Formula | C22H34FNO5Si |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(6-fluoro-2-methoxy-3-methylphenyl)methyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | COc1c(C)ccc(F)c1CN1O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]2[C@H](C)OC(=O)[C@H]21 |
| InChI | InChI=1S/C22H34FNO5Si/c1-13-9-10-16(23)15(20(13)26-6)11-24-19-18(14(2)28-21(19)25)17(29-24)12-27-30(7,8)22(3,4)5/h9-10,14,17-19H,11-12H2,1-8H3/t14-,17-,18+,19-/m0/s1 |
| InChIKey | PESAFFKSRVJUSM-FZDIXFNVSA-N |
| XLogP | 4.21 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|