C17H22BN3OS — CID 143635522
1-[2-[1-(3-cyclohexa-1,3-dien-1-ylpropyl)pyrazol-3-yl]-4-methyl-3H-1,3,2-thiazaborol-5-yl]ethanone (PubChem CID 143635522) has the molecular formula C17H22BN3OS and a molecular weight of 327.26 g/mol. Its IUPAC name is 1-[2-[1-(3-cyclohexa-1,3-dien-1-ylpropyl)pyrazol-3-yl]-4-methyl-3H-1,3,2-thiazaborol-5-yl]ethanone.
| Compound Name | 1-[2-[1-(3-cyclohexa-1,3-dien-1-ylpropyl)pyrazol-3-yl]-4-methyl-3H-1,3,2-thiazaborol-5-yl]ethanone |
|---|---|
| PubChem CID | 143635522 |
| Molecular Formula | C17H22BN3OS |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[2-[1-(3-cyclohexa-1,3-dien-1-ylpropyl)pyrazol-3-yl]-4-methyl-3H-1,3,2-thiazaborol-5-yl]ethanone |
| SMILES | CC(=O)C1=C(C)NB(c2ccn(CCCC3=CC=CCC3)n2)S1 |
| InChI | InChI=1S/C17H22BN3OS/c1-13-17(14(2)22)23-18(19-13)16-10-12-21(20-16)11-6-9-15-7-4-3-5-8-15/h3-4,7,10,12,19H,5-6,8-9,11H2,1-2H3 |
| InChIKey | ISQJGUYYKWOIQE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|