About (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane
(2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane (PubChem CID 143635962) has the molecular formula C9H23NO
and a molecular weight of 161.29 g/mol. Its IUPAC name is (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane.
Molecular Properties
| Compound Name | (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane |
| PubChem CID | 143635962 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane |
| SMILES | CCC.COC[C@H]1CCCN1.[H][H] |
| InChI | InChI=1S/C6H13NO.C3H8.H2/c1-8-5-6-3-2-4-7-6;1-3-2;/h6-7H,2-5H2,1H3;3H2,1-2H3;1H/t6-;;/m1../s1 |
| InChIKey | JHCCAZFAKOYUIJ-QYCVXMPOSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane?
The IUPAC name of (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane (CID 143635962) is (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane.
What is the SMILES notation for (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane?
The canonical SMILES for (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane is CCC.COC[C@H]1CCCN1.[H][H].
What is the InChIKey of (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane?
The InChIKey is JHCCAZFAKOYUIJ-QYCVXMPOSA-N. The full InChI is InChI=1S/C6H13NO.C3H8.H2/c1-8-5-6-3-2-4-7-6;1-3-2;/h6-7H,2-5H2,1H3;3H2,1-2H3;1H/t6-;;/m1../s1.
What are the key properties of (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane?
(2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane has a molecular weight of 161.29 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(methoxymethyl)pyrrolidine;molecular hydrogen;propane is sourced from PubChem (CID 143635962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).