C20H23N3 — CID 143636823
6-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)isoquinolin-1-amine (PubChem CID 143636823) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 6-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)isoquinolin-1-amine.
| Compound Name | 6-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 143636823 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 6-(3,6,6-trimethyl-5,7-dihydro-4H-indol-1-yl)isoquinolin-1-amine |
| SMILES | Cc1cn(-c2ccc3c(N)nccc3c2)c2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C20H23N3/c1-13-12-23(18-11-20(2,3)8-6-16(13)18)15-4-5-17-14(10-15)7-9-22-19(17)21/h4-5,7,9-10,12H,6,8,11H2,1-3H3,(H2,21,22) |
| InChIKey | GGLPSCYLCSTGGO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |