C12H19NO — CID 143637448
ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methyl-1,3-oxazole (PubChem CID 143637448) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methyl-1,3-oxazole.
| Compound Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 143637448 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methyl-1,3-oxazole |
| SMILES | C/C=C\C(=C/C)c1coc(C)n1.CC |
| InChI | InChI=1S/C10H13NO.C2H6/c1-4-6-9(5-2)10-7-12-8(3)11-10;1-2/h4-7H,1-3H3;1-2H3/b6-4-,9-5+; |
| InChIKey | JTHQKNDGKXYYQX-AFPQSWDMSA-N |
| XLogP | 3.99 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|