C13H18N2 — CID 143637572
(3aR)-2,4,7-trimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indole (PubChem CID 143637572) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (3aR)-2,4,7-trimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indole.
| Compound Name | (3aR)-2,4,7-trimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indole |
|---|---|
| PubChem CID | 143637572 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (3aR)-2,4,7-trimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indole |
| SMILES | Cc1ccc2c(c1)C1CN(C)C[C@@H]1N2C |
| InChI | InChI=1S/C13H18N2/c1-9-4-5-12-10(6-9)11-7-14(2)8-13(11)15(12)3/h4-6,11,13H,7-8H2,1-3H3/t11?,13-/m0/s1 |
| InChIKey | TZOISZOQFYWJQA-YUZLPWPTSA-N |
| XLogP | 1.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |