C19H22N6O3 — CID 143638382
5-(cyclopropylamino)-3-[2-(2-hydroxyethylamino)ethylamino]pyrimido[4,5-c]quinoline-8-carboxylic acid (PubChem CID 143638382) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-(cyclopropylamino)-3-[2-(2-hydroxyethylamino)ethylamino]pyrimido[4,5-c]quinoline-8-carboxylic acid.
| Compound Name | 5-(cyclopropylamino)-3-[2-(2-hydroxyethylamino)ethylamino]pyrimido[4,5-c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 143638382 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-(cyclopropylamino)-3-[2-(2-hydroxyethylamino)ethylamino]pyrimido[4,5-c]quinoline-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(NC1CC1)c1nc(NCCNCCO)ncc12 |
| InChI | InChI=1S/C19H22N6O3/c26-8-7-20-5-6-21-19-22-10-14-13-4-1-11(18(27)28)9-15(13)24-17(16(14)25-19)23-12-2-3-12/h1,4,9-10,12,20,26H,2-3,5-8H2,(H,23,24)(H,27,28)(H,21,22,25) |
| InChIKey | KLLOQVZDIAGYOE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|