C16H31NO3 — CID 143638662
tert-butyl N-[(3R)-6-[(2-methylpropan-2-yl)oxy]hept-6-en-3-yl]carbamate (PubChem CID 143638662) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-[(3R)-6-[(2-methylpropan-2-yl)oxy]hept-6-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-6-[(2-methylpropan-2-yl)oxy]hept-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 143638662 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | tert-butyl N-[(3R)-6-[(2-methylpropan-2-yl)oxy]hept-6-en-3-yl]carbamate |
| SMILES | C=C(CC[C@@H](CC)NC(=O)OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-9-13(17-14(18)20-16(6,7)8)11-10-12(2)19-15(3,4)5/h13H,2,9-11H2,1,3-8H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | WBZCGNHJRRYCMP-CYBMUJFWSA-N |
| XLogP | 4.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|