C8H12N2O — CID 14363885
4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one (PubChem CID 14363885) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one.
| Compound Name | 4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one |
|---|---|
| PubChem CID | 14363885 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one |
| SMILES | O=C1CC2CCCCC2=NN1 |
| InChI | InChI=1S/C8H12N2O/c11-8-5-6-3-1-2-4-7(6)9-10-8/h6H,1-5H2,(H,10,11) |
| InChIKey | IQFSAXTWECTQKQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |