C38H34BrNO3 — CID 143638990
1-[4-[6-(4-bromophenyl)-3-cyclohepta-1,3,6-trien-1-yl-8,9-dimethoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine (PubChem CID 143638990) has the molecular formula C38H34BrNO3 and a molecular weight of 632.60 g/mol. Its IUPAC name is 1-[4-[6-(4-bromophenyl)-3-cyclohepta-1,3,6-trien-1-yl-8,9-dimethoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine.
| Compound Name | 1-[4-[6-(4-bromophenyl)-3-cyclohepta-1,3,6-trien-1-yl-8,9-dimethoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine |
|---|---|
| PubChem CID | 143638990 |
| Molecular Formula | C38H34BrNO3 |
| Molecular Weight | 632.60 g/mol |
| Exact Mass | 631.17 |
| IUPAC Name | 1-[4-[6-(4-bromophenyl)-3-cyclohepta-1,3,6-trien-1-yl-8,9-dimethoxybenzo[f]chromen-3-yl]phenyl]pyrrolidine |
| SMILES | COc1cc2c(-c3ccc(Br)cc3)cc3c(c2cc1OC)C=CC(C1=CC=CCC=C1)(c1ccc(N2CCCC2)cc1)O3 |
| InChI | InChI=1S/C38H34BrNO3/c1-41-36-24-33-31-19-20-38(27-9-5-3-4-6-10-27,28-13-17-30(18-14-28)40-21-7-8-22-40)43-35(31)23-32(34(33)25-37(36)42-2)26-11-15-29(39)16-12-26/h3,5-6,9-20,23-25H,4,7-8,21-22H2,1-2H3 |
| InChIKey | FGJMWRNAKIDBGM-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.60 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|