C25H39N9O3 — CID 143639886
3,5-diamino-6-methyl-N-[N'-[2-methyl-4-[4-[2-[4-(methylamino)butylamino]-2-oxoethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 143639886) has the molecular formula C25H39N9O3 and a molecular weight of 513.65 g/mol. Its IUPAC name is 3,5-diamino-6-methyl-N-[N'-[2-methyl-4-[4-[2-[4-(methylamino)butylamino]-2-oxoethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-methyl-N-[N'-[2-methyl-4-[4-[2-[4-(methylamino)butylamino]-2-oxoethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143639886 |
| Molecular Formula | C25H39N9O3 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 3,5-diamino-6-methyl-N-[N'-[2-methyl-4-[4-[2-[4-(methylamino)butylamino]-2-oxoethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CNCCCCNC(=O)COc1ccc(CCC(C)C/N=C(\N)NC(=O)c2nc(C)c(N)nc2N)cc1 |
| InChI | InChI=1S/C25H39N9O3/c1-16(14-31-25(28)34-24(36)21-23(27)33-22(26)17(2)32-21)6-7-18-8-10-19(11-9-18)37-15-20(35)30-13-5-4-12-29-3/h8-11,16,29H,4-7,12-15H2,1-3H3,(H,30,35)(H4,26,27,33)(H3,28,31,34,36) |
| InChIKey | ZUJTWUBULPIINE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 195.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|