C22H19F3N6O2 — CID 143640299
3-[1-[(1S)-1-amino-2,2,2-trifluoroethoxy]phthalazin-6-yl]-4-methyl-N-(2-methylpyrazol-3-yl)benzamide (PubChem CID 143640299) has the molecular formula C22H19F3N6O2 and a molecular weight of 456.43 g/mol. Its IUPAC name is 3-[1-[(1S)-1-amino-2,2,2-trifluoroethoxy]phthalazin-6-yl]-4-methyl-N-(2-methylpyrazol-3-yl)benzamide.
| Compound Name | 3-[1-[(1S)-1-amino-2,2,2-trifluoroethoxy]phthalazin-6-yl]-4-methyl-N-(2-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 143640299 |
| Molecular Formula | C22H19F3N6O2 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[1-[(1S)-1-amino-2,2,2-trifluoroethoxy]phthalazin-6-yl]-4-methyl-N-(2-methylpyrazol-3-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccnn2C)cc1-c1ccc2c(O[C@H](N)C(F)(F)F)nncc2c1 |
| InChI | InChI=1S/C22H19F3N6O2/c1-12-3-4-14(19(32)29-18-7-8-28-31(18)2)10-17(12)13-5-6-16-15(9-13)11-27-30-20(16)33-21(26)22(23,24)25/h3-11,21H,26H2,1-2H3,(H,29,32)/t21-/m0/s1 |
| InChIKey | LCFPEZKXRJPARH-NRFANRHFSA-N |
| XLogP | 3.82 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|