C13H19N5 — CID 143640324
13-ethyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-10,12,14-trien-10-amine (PubChem CID 143640324) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 13-ethyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-10,12,14-trien-10-amine.
| Compound Name | 13-ethyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-10,12,14-trien-10-amine |
|---|---|
| PubChem CID | 143640324 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 13-ethyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-10,12,14-trien-10-amine |
| SMILES | CCc1nc2c3n1CCN1CCCC(NC=2N)C=31 |
| InChI | InChI=1S/C13H19N5/c1-2-9-16-10-12-11-8(15-13(10)14)4-3-5-17(11)6-7-18(9)12/h8,15H,2-7,14H2,1H3 |
| InChIKey | BXBKHOYLFKNWET-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |