About 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one
3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one (PubChem CID 143640419) has the molecular formula C15H14N2O4
and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 143640419 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CC(c1ccccc1)c1ccon1)N1CCOC1=O |
| InChI | InChI=1S/C15H14N2O4/c18-14(17-7-9-20-15(17)19)10-12(13-6-8-21-16-13)11-4-2-1-3-5-11/h1-6,8,12H,7,9-10H2 |
| InChIKey | FWYINKQVHPUUMH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one (CID 143640419) is 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one is O=C(CC(c1ccccc1)c1ccon1)N1CCOC1=O.
What is the InChIKey of 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one?
The InChIKey is FWYINKQVHPUUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O4/c18-14(17-7-9-20-15(17)19)10-12(13-6-8-21-16-13)11-4-2-1-3-5-11/h1-6,8,12H,7,9-10H2.
What are the key properties of 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one?
3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one has a molecular weight of 286.29 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1,2-oxazol-3-yl)-3-phenylpropanoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 143640419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).