C13H17IO — CID 143640530
7-iodo-1,1,4,4-tetramethyl-3H-isochromene (PubChem CID 143640530) has the molecular formula C13H17IO and a molecular weight of 316.18 g/mol. Its IUPAC name is 7-iodo-1,1,4,4-tetramethyl-3H-isochromene.
| Compound Name | 7-iodo-1,1,4,4-tetramethyl-3H-isochromene |
|---|---|
| PubChem CID | 143640530 |
| Molecular Formula | C13H17IO |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 7-iodo-1,1,4,4-tetramethyl-3H-isochromene |
| SMILES | CC1(C)COC(C)(C)c2cc(I)ccc21 |
| InChI | InChI=1S/C13H17IO/c1-12(2)8-15-13(3,4)11-7-9(14)5-6-10(11)12/h5-7H,8H2,1-4H3 |
| InChIKey | YMLIAAUTCBIPEX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|