C29H31N3O4 — CID 143640840
4-imino-4-[methanimidoyl(methyl)amino]-3-[4-[(6-phenoxy-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]phenyl]butanoic acid (PubChem CID 143640840) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-imino-4-[methanimidoyl(methyl)amino]-3-[4-[(6-phenoxy-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]phenyl]butanoic acid.
| Compound Name | 4-imino-4-[methanimidoyl(methyl)amino]-3-[4-[(6-phenoxy-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 143640840 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 4-imino-4-[methanimidoyl(methyl)amino]-3-[4-[(6-phenoxy-5,6,7,8-tetrahydronaphthalen-2-yl)methoxy]phenyl]butanoic acid |
| SMILES | [H]/N=C(/C(CC(=O)O)c1ccc(OCc2ccc3c(c2)CCC(Oc2ccccc2)C3)cc1)N(C)/C=N/[H] |
| InChI | InChI=1S/C29H31N3O4/c1-32(19-30)29(31)27(17-28(33)34)21-9-12-24(13-10-21)35-18-20-7-8-23-16-26(14-11-22(23)15-20)36-25-5-3-2-4-6-25/h2-10,12-13,15,19,26-27,30-31H,11,14,16-18H2,1H3,(H,33,34)/b30-19+,31-29- |
| InChIKey | KDBCAJAOZJVHOO-COAHKADWSA-N |
| XLogP | 5.28 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|