About 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane
2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane (PubChem CID 143641044) has the molecular formula C14H20N2OS
and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane.
Molecular Properties
| Compound Name | 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane |
| PubChem CID | 143641044 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane |
| SMILES | CC.N#COSCCc1ccc(CN2CC2)cc1 |
| InChI | InChI=1S/C12H14N2OS.C2H6/c13-10-15-16-8-5-11-1-3-12(4-2-11)9-14-6-7-14;1-2/h1-4H,5-9H2;1-2H3 |
| InChIKey | JJUSVLJEJFTDMX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane?
The IUPAC name of 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane (CID 143641044) is 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane.
What is the SMILES notation for 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane?
The canonical SMILES for 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane is CC.N#COSCCc1ccc(CN2CC2)cc1.
What is the InChIKey of 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane?
The InChIKey is JJUSVLJEJFTDMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS.C2H6/c13-10-15-16-8-5-11-1-3-12(4-2-11)9-14-6-7-14;1-2/h1-4H,5-9H2;1-2H3.
What are the key properties of 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane?
2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane has a molecular weight of 264.39 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(aziridin-1-ylmethyl)phenyl]ethylsulfanyl cyanate;ethane is sourced from PubChem (CID 143641044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).