About 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline
2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline (PubChem CID 143641423) has the molecular formula C23H28N2O4
and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline.
Molecular Properties
| Compound Name | 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline |
| PubChem CID | 143641423 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline |
| SMILES | CNc1cc(OC)c(OC)c(OC)c1.Cc1ccc(-c2cccc(N)c2O)cc1 |
| InChI | InChI=1S/C13H13NO.C10H15NO3/c1-9-5-7-10(8-6-9)11-3-2-4-12(14)13(11)15;1-11-7-5-8(12-2)10(14-4)9(6-7)13-3/h2-8,15H,14H2,1H3;5-6,11H,1-4H3 |
| InChIKey | BGDZWKKGELARGB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline?
The IUPAC name of 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline (CID 143641423) is 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline.
What is the SMILES notation for 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline?
The canonical SMILES for 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline is CNc1cc(OC)c(OC)c(OC)c1.Cc1ccc(-c2cccc(N)c2O)cc1.
What is the InChIKey of 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline?
The InChIKey is BGDZWKKGELARGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO.C10H15NO3/c1-9-5-7-10(8-6-9)11-3-2-4-12(14)13(11)15;1-11-7-5-8(12-2)10(14-4)9(6-7)13-3/h2-8,15H,14H2,1H3;5-6,11H,1-4H3.
What are the key properties of 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline?
2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline has a molecular weight of 396.49 g/mol, XLogP of 4.70, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(4-methylphenyl)phenol;3,4,5-trimethoxy-N-methylaniline is sourced from PubChem (CID 143641423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).