C30H40N4OS — CID 143641506
2-amino-6-[3-methyl-4-(methylsulfanylmethyl)phenyl]phenol;4-(4-cyclopropylpiperazin-1-yl)-N,3-dimethylaniline (PubChem CID 143641506) has the molecular formula C30H40N4OS and a molecular weight of 504.74 g/mol. Its IUPAC name is 2-amino-6-[3-methyl-4-(methylsulfanylmethyl)phenyl]phenol;4-(4-cyclopropylpiperazin-1-yl)-N,3-dimethylaniline.
| Compound Name | 2-amino-6-[3-methyl-4-(methylsulfanylmethyl)phenyl]phenol;4-(4-cyclopropylpiperazin-1-yl)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 143641506 |
| Molecular Formula | C30H40N4OS |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 2-amino-6-[3-methyl-4-(methylsulfanylmethyl)phenyl]phenol;4-(4-cyclopropylpiperazin-1-yl)-N,3-dimethylaniline |
| SMILES | CNc1ccc(N2CCN(C3CC3)CC2)c(C)c1.CSCc1ccc(-c2cccc(N)c2O)cc1C |
| InChI | InChI=1S/C15H23N3.C15H17NOS/c1-12-11-13(16-2)3-6-15(12)18-9-7-17(8-10-18)14-4-5-14;1-10-8-11(6-7-12(10)9-18-2)13-4-3-5-14(16)15(13)17/h3,6,11,14,16H,4-5,7-10H2,1-2H3;3-8,17H,9,16H2,1-2H3 |
| InChIKey | WHCZOXOAOGKGBY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|